DOTA-GA(tBu)4 is a protected derivative of a DOTA-based chelating agent, featuring tert-butyl ester protecting groups. It serves as a precursor in the synthesis of chelating agents used in research applications.
콘텐츠 범위: 이 페이지의 정보는 화학물질 식별 및 산업 공급·연구개발·제조 맥락을 대상으로 합니다. 치료 효능 주장, 의료 조언 또는 의약품 사용 지침에 해당하지 않습니다.
DOTA-GA(tBu)4 구매를 찾고 계신가요?
구매 요청을 무료로 등록하세요. 계정이 필요 없습니다. 이 제품을 공급할 수 있는 공급업체에 전달되며, 답변은 이메일로 바로 받습니다.
(S)-4-(4,7-Bis(2-(tert-butoxy)-2-oxoethyl)-1,4,7-triazonan-1-yl)-5-(tert-butoxy)-5-oxopentanoic acid
research reagent
(R)-NODAGA-tris(t-Bu ester)
chelating agent intermediate for bioconjugation
2,4-di(tert-butoxy)pyrimidin-5-ylboronic acid hydrate
Boron-containing research compound
Cu-TMEDA catalyst
coordination chemistry catalyst
5-bromopyridine-2-carboxylic acid
Research chemical intermediate
N-Acetyl-L-isoleucine
research compound
Tri-tert-butyl 1,4,7,10-tetraazacyclododecane-1,4,7,10-tetraacetate
protected macrocyclic chelating agent
Cyclen
macrocyclic ligand for metal chelation
5-[(2-methylpropan-2-yl)oxy]-5-oxo-4-[4,7,10-tris[2-[(2-methylpropan-2-yl)oxy]-2-oxoethyl]-1,4,7,10-tetrazacyclododec-1-yl]pentanoic acid
SUAUFMLRKFUOID-UHFFFAOYSA-N
CC(C)(C)OC(=O)CN1CCN(CCN(CCN(CC1)CC(=O)OC(C)(C)C)C(CCC(=O)O)C(=O)OC(C)(C)C)CC(=O)OC(C)(C)C
DOTA-GA(tBu)4 구매를 찾고 계신가요?
구매 요청을 무료로 등록하세요. 계정이 필요 없습니다. 이 제품을 공급할 수 있는 공급업체에 전달되며, 답변은 이메일로 바로 받습니다.