N-Acetyl-L-isoleucine is a derivative of the amino acid isoleucine, where the amino group is acetylated. It is primarily used as a research compound in laboratory settings.
콘텐츠 범위: 이 페이지의 정보는 화학물질 식별 및 산업 공급·연구개발·제조 맥락을 대상으로 합니다. 치료 효능 주장, 의료 조언 또는 의약품 사용 지침에 해당하지 않습니다.
이 화합물을 구매하거나 공급하시겠습니까?
재고를 등록하거나 구매 요청을 게시하세요
CAS 3077-46-1
Aluminum, chloro[[2,2'-[(1S,2S)-1,2-cyclohexanediylbis[(nitrilo-kappaN)methylidyne]]bis[4,6-bis(1,1-dimethylethyl)phenolato-kappaO]](2-)]-, (SP-5-13)-
asymmetric synthesis catalyst
L-4-Hydroxyphenyl-3,5-d2-alanine
deuterium-labeled reference compound
Methyl (S)-3-(7-bromo-2-oxo-5-(pyridin-2-yl)-2,3-dihydro-1H-benzo[e][1,4]diazepin-3-yl)propanoate
research reagent
Trimethylsulfonium bromide
Research reagent
(2S,3S)-2-acetamido-3-methylpentanoic acid
JDTWZSUNGHMMJM-FSPLSTOPSA-N
CC[C@H](C)[C@@H](C(=O)O)NC(=O)C