L-4-Hydroxyphenyl-3,5-d2-alanine is a deuterium-labeled derivative of the amino acid L-tyrosine, specifically deuterated at the 3 and 5 positions of the phenyl ring. It is used as a reference compound in analytical research, particularly for mass spectrometry and metabolic studies where isotopic labeling aids quantification.
콘텐츠 범위: 이 페이지의 정보는 화학물질 식별 및 산업 공급·연구개발·제조 맥락을 대상으로 합니다. 치료 효능 주장, 의료 조언 또는 의약품 사용 지침에 해당하지 않습니다.
이 화합물을 구매하거나 공급하시겠습니까?
재고를 등록하거나 구매 요청을 게시하세요
CAS 30811-19-9
Methyl (S)-3-(7-bromo-2-oxo-5-(pyridin-2-yl)-2,3-dihydro-1H-benzo[e][1,4]diazepin-3-yl)propanoate
research reagent
Trimethylsulfonium bromide
Research reagent
Trans-Cinnamic-d7 acid
deuterated analytical standard
DSG-PEG 2000
PEGylated lipid reagent
D-tyrosine
Research amino acid reagent
DL-Tyrosine
amino acid dietary supplement
티로신
nutritional supplement and flavoring agent
L-Tyrosine D4
stable isotope labeled research compound
(2S)-2-amino-3-(3,5-dideuterio-4-hydroxyphenyl)propanoic acid
OUYCCCASQSFEME-ZQCIBQAJSA-N
[2H]C1=CC(=CC(=C1O)[2H])C[C@@H](C(=O)O)N