L-Tyrosine-d7 is a deuterated form of the amino acid L-tyrosine, where seven hydrogen atoms are replaced with deuterium. It is primarily used as an internal standard in mass spectrometry for the quantification of L-tyrosine in biological samples.
콘텐츠 범위: 이 페이지의 정보는 화학물질 식별 및 산업 공급·연구개발·제조 맥락을 대상으로 합니다. 치료 효능 주장, 의료 조언 또는 의약품 사용 지침에 해당하지 않습니다.
L-tyrosine-d7 구매를 찾고 계신가요?
구매 요청을 무료로 등록하세요. 계정이 필요 없습니다. 이 제품을 공급할 수 있는 공급업체에 전달되며, 답변은 이메일로 바로 받습니다.
Methylboronic acid
research compound
L-Cysteine-d2
research compound
3-Bromo-5-fluorobenzotrifluoride
research reagent
Hexyl (amino(4-aminophenyl)methylene)carbamate hydrochloride
research compound
L-Tyrosine-13C6
stable isotope labeled reference standard
L-4-Hydroxyphenyl-3,5-d2-alanine
deuterium-labeled reference compound
D-tyrosine
Research amino acid reagent
DL-Tyrosine
amino acid dietary supplement
(2S)-2-amino-2,3,3-trideuterio-3-(2,3,5,6-tetradeuterio-4-hydroxyphenyl)propanoic acid
OUYCCCASQSFEME-BKKGXISKSA-N
[2H]C1=C(C(=C(C(=C1C([2H])([2H])[C@@]([2H])(C(=O)O)N)[2H])[2H])O)[2H]
L-tyrosine-d7 구매를 찾고 계신가요?
구매 요청을 무료로 등록하세요. 계정이 필요 없습니다. 이 제품을 공급할 수 있는 공급업체에 전달되며, 답변은 이메일로 바로 받습니다.