L-Cysteine-d2 is a deuterium-labeled form of the amino acid L-cysteine, specifically deuterated at the beta-carbon. It is primarily used as a research compound for studies involving metabolic tracing and protein labeling.
콘텐츠 범위: 이 페이지의 정보는 화학물질 식별 및 산업 공급·연구개발·제조 맥락을 대상으로 합니다. 치료 효능 주장, 의료 조언 또는 의약품 사용 지침에 해당하지 않습니다.
이 화합물을 구매하거나 공급하시겠습니까?
재고를 등록하거나 구매 요청을 게시하세요
CAS 130633-02-2
3-Bromo-5-fluorobenzotrifluoride
research reagent
Hexyl (amino(4-aminophenyl)methylene)carbamate hydrochloride
research compound
(3-(Dibenzo[b,d]thiophen-4-yl)phenyl)boronic acid
Boronic acid building block
Bicyclo[2.2.1]hept-5-en-2-ol
chemical intermediate for synthesis
D-Cysteine hydrochloride
research compound
Cystein chloride
dough conditioner and nutritional supplement
L-cysteine
Flavor and nutrition additive
L-Cysteine hydrochloride monohydrate
flavor enhancer and nutritional supplement
(2R)-2-amino-3,3-dideuterio-3-sulfanylpropanoic acid
XUJNEKJLAYXESH-XFJCSJJYSA-N
[2H]C([2H])([C@@H](C(=O)O)N)S