3-Bromo-5-fluorobenzotrifluoride is an aromatic compound containing bromine, fluorine, and a trifluoromethyl group. It is primarily used as a research reagent in chemical synthesis and laboratory applications.
콘텐츠 범위: 이 페이지의 정보는 화학물질 식별 및 산업 공급·연구개발·제조 맥락을 대상으로 합니다. 치료 효능 주장, 의료 조언 또는 의약품 사용 지침에 해당하지 않습니다.
이 화합물을 구매하거나 공급하시겠습니까?
재고를 등록하거나 구매 요청을 게시하세요
CAS 130723-13-6
Hexyl (amino(4-aminophenyl)methylene)carbamate hydrochloride
research compound
(3-(Dibenzo[b,d]thiophen-4-yl)phenyl)boronic acid
Boronic acid building block
Bicyclo[2.2.1]hept-5-en-2-ol
chemical intermediate for synthesis
Pyridin-4-ylmethanesulfonyl Chloride
research chemical for synthesis
1-bromo-3-fluoro-5-(trifluoromethyl)benzene
LIGBGEJPUQBLTG-UHFFFAOYSA-N
C1=C(C=C(C=C1F)Br)C(F)(F)F
—