Lamotrigine-13C3,d3 is a stable isotope-labeled variant of lamotrigine, where specific carbon atoms are replaced with carbon-13 and hydrogen atoms are replaced with deuterium. It is primarily used as a research standard in analytical and biomedical studies.
콘텐츠 범위: 이 페이지의 정보는 화학물질 식별 및 산업 공급·연구개발·제조 맥락을 대상으로 합니다. 치료 효능 주장, 의료 조언 또는 의약품 사용 지침에 해당하지 않습니다.
Lamotrigine-13C3,d3 구매를 찾고 계신가요?
구매 요청을 무료로 등록하세요. 계정이 필요 없습니다. 이 제품을 공급할 수 있는 공급업체에 전달되며, 답변은 이메일로 바로 받습니다.
Octanoyl L-Carnitine-d3 Chloride
isotopically labeled research standard
N-tetracosane-d50
isotopically labeled research standard
1,2,3-trichloropropane (d5)
isotopically labeled research standard
DL-MEVALONOLACTONE-4,4,5,5-D4
isotopically labeled research standard
3-Methoxy Acetaminophen-d3
deuterated research compound
3-Methylmethcathinone
research chemical
2-Acetamido-5-mercapto-1,3,4-thiadiazole-d3
deuterium-labeled reference standard
A-Methyl Fentanyl-d3 Hydrochloride
reference standard
6-(2,3-dichloro-4,5,6-trideuteriophenyl)-(3,5,6-13C3)1,2,4-triazine-3,5-diamine
PYZRQGJRPPTADH-MKOZQUTQSA-N
[2H]C1=C(C(=C(C(=C1[2H])Cl)Cl)[13C]2=[13C](N=[13C](N=N2)N)N)[2H]
Lamotrigine-13C3,d3 구매를 찾고 계신가요?
구매 요청을 무료로 등록하세요. 계정이 필요 없습니다. 이 제품을 공급할 수 있는 공급업체에 전달되며, 답변은 이메일로 바로 받습니다.