3-Nitrobenzyl-d6 alcohol is a stable isotope labeled research compound in which six hydrogen atoms are replaced by deuterium. It is used as a tracer or internal standard in analytical studies to track the behavior of the parent compound.
콘텐츠 범위: 이 페이지의 정보는 화학물질 식별 및 산업 공급·연구개발·제조 맥락을 대상으로 합니다. 치료 효능 주장, 의료 조언 또는 의약품 사용 지침에 해당하지 않습니다.
3-nitrobenzyl-d6 alcohol 구매를 찾고 계신가요?
구매 요청을 무료로 등록하세요. 계정이 필요 없습니다. 이 제품을 공급할 수 있는 공급업체에 전달되며, 답변은 이메일로 바로 받습니다.
Menaquinone 7-d7
stable isotope labeled research compound
1,14-TETRADECANEDIOIC-D24 ACID
stable isotope labeled research compound
Myristoyl-L-carnitine-d3 Hydrochloride
stable isotope labeled research compound
Palmitoyl-L-carnitine-d3 Hydrochloride
stable isotope labeled research compound
2,4'-Dichlorobiphenyl-d8
Deuterated analytical reference standard
2-Methoxynaphthalene-1,3,4,5,6,7,8-d7
research reagent
2-Chlorobenzoic Acid-d4
deuterated analytical reference standard
2,4,6-TRIBROMOPHENOL-3,5-D2
deuterated research compound
dideuterio-(2,3,4,6-tetradeuterio-5-nitrophenyl)methanol
CWNPOQFCIIFQDM-NVSFMWKBSA-N
[2H]C1=C(C(=C(C(=C1[2H])[N+](=O)[O-])[2H])C([2H])([2H])O)[2H]
3-nitrobenzyl-d6 alcohol 구매를 찾고 계신가요?
구매 요청을 무료로 등록하세요. 계정이 필요 없습니다. 이 제품을 공급할 수 있는 공급업체에 전달되며, 답변은 이메일로 바로 받습니다.