2,4'-Dichlorobiphenyl-d8 is a deuterated analytical reference standard, specifically a polychlorinated biphenyl (PCB) congener where all hydrogen atoms on the biphenyl rings are replaced with deuterium. It is primarily used as an internal standard or labeled surrogate in mass spectrometry and analytical chemistry for the quantification and tracing of PCB compounds in environmental and research samples.
콘텐츠 범위: 이 페이지의 정보는 화학물질 식별 및 산업 공급·연구개발·제조 맥락을 대상으로 합니다. 치료 효능 주장, 의료 조언 또는 의약품 사용 지침에 해당하지 않습니다.
2,4'-Dichlorobiphenyl-d8 구매를 찾고 계신가요?
구매 요청을 무료로 등록하세요. 계정이 필요 없습니다. 이 제품을 공급할 수 있는 공급업체에 전달되며, 답변은 이메일로 바로 받습니다.
2-Methoxynaphthalene-1,3,4,5,6,7,8-d7
research reagent
2-Chlorobenzoic Acid-d4
deuterated analytical reference standard
2,4,6-TRIBROMOPHENOL-3,5-D2
deuterated research compound
2-nitrobenzonitrile-d4
deuterated internal standard
2,4'-DICHLOROBIPHENYL
industrial chemical intermediate
1-chloro-2-(4-chloro-2,3,5,6-tetradeuteriophenyl)-3,4,5,6-tetradeuteriobenzene
UFNIBRDIUNVOMX-PGRXLJNUSA-N
[2H]C1=C(C(=C(C(=C1[2H])C2=C(C(=C(C(=C2[2H])[2H])Cl)[2H])[2H])Cl)[2H])[2H]
2,4'-Dichlorobiphenyl-d8 구매를 찾고 계신가요?
구매 요청을 무료로 등록하세요. 계정이 필요 없습니다. 이 제품을 공급할 수 있는 공급업체에 전달되며, 답변은 이메일로 바로 받습니다.