2,4,6-Tribromophenol-3,5-d2 is a deuterated form of tribromophenol, specifically labeled with deuterium atoms at the 3 and 5 positions on the aromatic ring. It is primarily used as a research compound in analytical chemistry and synthetic studies where isotopic labeling is required.
콘텐츠 범위: 이 페이지의 정보는 화학물질 식별 및 산업 공급·연구개발·제조 맥락을 대상으로 합니다. 치료 효능 주장, 의료 조언 또는 의약품 사용 지침에 해당하지 않습니다.
2,4,6-TRIBROMOPHENOL-3,5-D2 구매를 찾고 계신가요?
구매 요청을 무료로 등록하세요. 계정이 필요 없습니다. 이 제품을 공급할 수 있는 공급업체에 전달되며, 답변은 이메일로 바로 받습니다.
2-nitrobenzonitrile-d4
deuterated internal standard
2-Bromochlorobenzene-d4
deuterated research reagent
Ethyl paraben-d4
deuterated internal standard
(+/-)-tetrahydro-2-furoic-d7 acid
deuterated research reagent
2,4,6-tribromophenol
flame retardant intermediate
2,4,6-tribromo-3,5-dideuteriophenol
BSWWXRFVMJHFBN-QDNHWIQGSA-N
[2H]C1=C(C(=C(C(=C1Br)O)Br)[2H])Br
2,4,6-TRIBROMOPHENOL-3,5-D2 구매를 찾고 계신가요?
구매 요청을 무료로 등록하세요. 계정이 필요 없습니다. 이 제품을 공급할 수 있는 공급업체에 전달되며, 답변은 이메일로 바로 받습니다.