2-Bromochlorobenzene-d4 is a deuterated research reagent, specifically a tetradeuterated derivative of 1-bromo-2-chlorobenzene. It is used as a stable isotope-labeled compound in laboratory research and analytical chemistry.
콘텐츠 범위: 이 페이지의 정보는 화학물질 식별 및 산업 공급·연구개발·제조 맥락을 대상으로 합니다. 치료 효능 주장, 의료 조언 또는 의약품 사용 지침에 해당하지 않습니다.
2-Bromochlorobenzene-d4 구매를 찾고 계신가요?
구매 요청을 무료로 등록하세요. 계정이 필요 없습니다. 이 제품을 공급할 수 있는 공급업체에 전달되며, 답변은 이메일로 바로 받습니다.
Ethyl paraben-d4
deuterated internal standard
(+/-)-tetrahydro-2-furoic-d7 acid
deuterated research reagent
2,3,3',4,4',5-Hexachlorobiphenyl-2',6,6'-d3
deuterated reference standard for PCB analysis
2,3,5,6-Tetradeuterio-4-nitrobenzonitrile
deuterium-labeled reference standard
1-Bromo-2-chlorobenzene
organic synthesis intermediate
1-Bromo-2-chlorobenzene
chemical intermediate
1-bromo-2-chloro-3,4,5,6-tetradeuteriobenzene
QBELEDRHMPMKHP-RHQRLBAQSA-N
[2H]C1=C(C(=C(C(=C1[2H])Cl)Br)[2H])[2H]
2-Bromochlorobenzene-d4 구매를 찾고 계신가요?
구매 요청을 무료로 등록하세요. 계정이 필요 없습니다. 이 제품을 공급할 수 있는 공급업체에 전달되며, 답변은 이메일로 바로 받습니다.