Menaquinone 7-d7 is a stable isotope labeled research compound used primarily for analytical and investigative purposes. It is a deuterated form of menaquinone-7 that is used as an internal standard in mass spectrometry.
콘텐츠 범위: 이 페이지의 정보는 화학물질 식별 및 산업 공급·연구개발·제조 맥락을 대상으로 합니다. 치료 효능 주장, 의료 조언 또는 의약품 사용 지침에 해당하지 않습니다.
Menaquinone 7-d7 구매를 찾고 계신가요?
구매 요청을 무료로 등록하세요. 계정이 필요 없습니다. 이 제품을 공급할 수 있는 공급업체에 전달되며, 답변은 이메일로 바로 받습니다.
1,14-TETRADECANEDIOIC-D24 ACID
stable isotope labeled research compound
Myristoyl-L-carnitine-d3 Hydrochloride
stable isotope labeled research compound
Palmitoyl-L-carnitine-d3 Hydrochloride
stable isotope labeled research compound
4,6-Dichloro-1,3-dinitrobenzene-13C6
stable isotope labeled research compound
1-(5-Bromo-4-chlorothiophen-2-yl)ethan-1-one
research compound
XMD 8-92
protein kinase inhibitor research tool
2-Chloroethyl trityl ether
research compound
Pentamethylcyclopentadienyliridium dichloride
organometallic synthesis reagent
5,6,7,8-tetradeuterio-2-[(2E,6E,10E,14E,18E,22E)-3,7,11,15,19,23,27-heptamethyloctacosa-2,6,10,14,18,22,26-heptaenyl]-3-(trideuteriomethyl)naphthalene-1,4-dione
RAKQPZMEYJZGPI-HRQALKRPSA-N
[2H]C1=C(C(=C2C(=C1[2H])C(=O)C(=C(C2=O)C([2H])([2H])[2H])C/C=C(\C)/CC/C=C(\C)/CC/C=C(\C)/CC/C=C(\C)/CC/C=C(\C)/CC/C=C(\C)/CCC=C(C)C)[2H])[2H]
Menaquinone 7-d7 구매를 찾고 계신가요?
구매 요청을 무료로 등록하세요. 계정이 필요 없습니다. 이 제품을 공급할 수 있는 공급업체에 전달되며, 답변은 이메일로 바로 받습니다.