4-N-Butylaniline-D15 is a deuterated research reagent, specifically a fully deuterated analog of 4-n-butylaniline where all hydrogen atoms are replaced with deuterium. This compound is primarily used in analytical and biochemical studies where isotopic labeling is required to trace or quantify chemical pathways.
콘텐츠 범위: 이 페이지의 정보는 화학물질 식별 및 산업 공급·연구개발·제조 맥락을 대상으로 합니다. 치료 효능 주장, 의료 조언 또는 의약품 사용 지침에 해당하지 않습니다.
4-N-BUTYLANILINE-D15 구매를 찾고 계신가요?
구매 요청을 무료로 등록하세요. 계정이 필요 없습니다. 이 제품을 공급할 수 있는 공급업체에 전달되며, 답변은 이메일로 바로 받습니다.
3,5-Dichloroaniline-d3
deuterated research compound
1,2,3,5-tetramethylbenzene-d14
deuterated research reference standard
3-nitrobenzyl-d6 alcohol
stable isotope labeled research compound
2,4'-Dichlorobiphenyl-d8
Deuterated analytical reference standard
4-Butylaniline
liquid crystal intermediate
4-Butylaniline
liquid crystal precursor and research compound
N,N,2,3,5,6-hexadeuterio-4-(1,1,2,2,3,3,4,4,4-nonadeuteriobutyl)aniline
OGIQUQKNJJTLSZ-RRFMZHHTSA-N
[2H]C1=C(C(=C(C(=C1C([2H])([2H])C([2H])([2H])C([2H])([2H])C([2H])([2H])[2H])[2H])[2H])N([2H])[2H])[2H]
4-N-BUTYLANILINE-D15 구매를 찾고 계신가요?
구매 요청을 무료로 등록하세요. 계정이 필요 없습니다. 이 제품을 공급할 수 있는 공급업체에 전달되며, 답변은 이메일로 바로 받습니다.