3,5-Dichloroaniline-d3 is a deuterated form of 3,5-dichloroaniline, where three hydrogen atoms are replaced with deuterium. It is primarily used as a research compound in chemical and pharmaceutical development, particularly for studying metabolic pathways and reaction mechanisms.
콘텐츠 범위: 이 페이지의 정보는 화학물질 식별 및 산업 공급·연구개발·제조 맥락을 대상으로 합니다. 치료 효능 주장, 의료 조언 또는 의약품 사용 지침에 해당하지 않습니다.
3,5-Dichloroaniline-d3 구매를 찾고 계신가요?
구매 요청을 무료로 등록하세요. 계정이 필요 없습니다. 이 제품을 공급할 수 있는 공급업체에 전달되며, 답변은 이메일로 바로 받습니다.
1,2,3,5-tetramethylbenzene-d14
deuterated research reference standard
3-nitrobenzyl-d6 alcohol
stable isotope labeled research compound
2,4'-Dichlorobiphenyl-d8
Deuterated analytical reference standard
2-Methoxynaphthalene-1,3,4,5,6,7,8-d7
research reagent
3,5-DICHLOROANILINE
Intermediate for fungicides production
3,5-dichloro-N,N,2-trideuterioaniline
UQRLKWGPEVNVHT-MNUMRPGMSA-N
[2H]C1=C(C=C(C=C1Cl)Cl)N([2H])[2H]
3,5-Dichloroaniline-d3 구매를 찾고 계신가요?
구매 요청을 무료로 등록하세요. 계정이 필요 없습니다. 이 제품을 공급할 수 있는 공급업체에 전달되며, 답변은 이메일로 바로 받습니다.