(+/-)-SEC-BUTYL-D9 ALCOHOL is a deuterated research standard, specifically a nonadeuterated form of 2-butanol where all nine hydrogen atoms are replaced with deuterium. It is primarily used as a reference compound in analytical chemistry and mass spectrometry to support quantitative analysis and method validation.
콘텐츠 범위: 이 페이지의 정보는 화학물질 식별 및 산업 공급·연구개발·제조 맥락을 대상으로 합니다. 치료 효능 주장, 의료 조언 또는 의약품 사용 지침에 해당하지 않습니다.
(+/-)-SEC-BUTYL-D9 ALCOHOL 구매를 찾고 계신가요?
구매 요청을 무료로 등록하세요. 계정이 필요 없습니다. 이 제품을 공급할 수 있는 공급업체에 전달되며, 답변은 이메일로 바로 받습니다.
4-[[2-(4-amino-3,5-dichlorophenyl)-2-hydroxyethyl]amino]-1,2,2,3,3,4,5,5,6,6-decadeuteriocyclohexan-1-ol
Deuterated research standard
1,2-DIMETHOXYBENZENE-3,4,5,6-D4
Deuterated research standard
(+/-)-Carazolol-d7 HCl (iso-propyl-d7)
Deuterated research standard
2-Chloro-4,6-bis(phenyl-d5)-1,3,5-triazine
Deuterated research standard
Di-n-nonyl phthalate-3,4,5,6-d4
Deuterated analytical reference standard
1-Nitrosotryptophol
nitrosamine reference standard
(S)-2-((tert-butoxycarbonyl)amino)-2-(2-(trifluoromethyl)phenyl)acetic acid
research compound
Tert-butyl 4-iodobenzoate
Research chemical intermediate
1,1,1,2,3,3,4,4,4-nonadeuteriobutan-2-ol
BTANRVKWQNVYAZ-CBZKUFJVSA-N
[2H]C([2H])([2H])C([2H])([2H])C([2H])(C([2H])([2H])[2H])O
(+/-)-SEC-BUTYL-D9 ALCOHOL 구매를 찾고 계신가요?
구매 요청을 무료로 등록하세요. 계정이 필요 없습니다. 이 제품을 공급할 수 있는 공급업체에 전달되며, 답변은 이메일로 바로 받습니다.