This compound is a deuterated research standard, specifically a chlorinated triazine derivative with perdeuterated phenyl rings. It is used as an analytical reference material for mass spectrometry and other quantitative techniques due to its stable isotope labeling.
콘텐츠 범위: 이 페이지의 정보는 화학물질 식별 및 산업 공급·연구개발·제조 맥락을 대상으로 합니다. 치료 효능 주장, 의료 조언 또는 의약품 사용 지침에 해당하지 않습니다.
2-Chloro-4,6-bis(phenyl-d5)-1,3,5-triazine 구매를 찾고 계신가요?
구매 요청을 무료로 등록하세요. 계정이 필요 없습니다. 이 제품을 공급할 수 있는 공급업체에 전달되며, 답변은 이메일로 바로 받습니다.
2,4-Dichloro-6-phenyl-1,3,5-triazine-d5
deuterated research reagent
(+)-Lysergide-d10
Deuterated research standard
Sulfadoxine-d4 (benzene-d4)
Deuterated research standard
4-[[2-(4-amino-3,5-dichlorophenyl)-2-hydroxyethyl]amino]-1,2,2,3,3,4,5,5,6,6-decadeuteriocyclohexan-1-ol
Deuterated research standard
1-Bromoeicosane-d41
Deuterated research standard
(1,10-Phenanthroline)(trifluoromethyl)copper(I)
research reagent for cross-coupling reactions
L-Methionine-d3
isotopically labeled research compound
Propan-2-yl-oxocyclobutane carboxylate
research compound
2-chloro-4,6-bis(2,3,4,5,6-pentadeuteriophenyl)-1,3,5-triazine
DDGPPAMADXTGTN-LHNTUAQVSA-N
[2H]C1=C(C(=C(C(=C1[2H])[2H])C2=NC(=NC(=N2)Cl)C3=C(C(=C(C(=C3[2H])[2H])[2H])[2H])[2H])[2H])[2H]
—
2-Chloro-4,6-bis(phenyl-d5)-1,3,5-triazine 구매를 찾고 계신가요?
구매 요청을 무료로 등록하세요. 계정이 필요 없습니다. 이 제품을 공급할 수 있는 공급업체에 전달되며, 답변은 이메일로 바로 받습니다.