(+)-Lysergide-d10 is a deuterated analytical standard used in quantitative mass spectrometry and forensic toxicology. Its structure incorporates ten deuterium atoms, providing an internal standard for the detection and quantification of lysergic acid diethylamide (LSD) in biological matrices.
콘텐츠 범위: 이 페이지의 정보는 화학물질 식별 및 산업 공급·연구개발·제조 맥락을 대상으로 합니다. 치료 효능 주장, 의료 조언 또는 의약품 사용 지침에 해당하지 않습니다.
이 화합물을 구매하거나 공급하시겠습니까?
재고를 등록하거나 구매 요청을 게시하세요
CAS 1794752-84-3
2-Chloro-4,6-bis(phenyl-d5)-1,3,5-triazine
Deuterated research standard
4-amino-2,3,5,6-tetradeuterio-N-(4,6-dimethylpyrimidin-2-yl)benzenesulfonamide
Deuterated research standard
Sulfamerazine D4
Deuterated research standard
1-chloro-3-iodobenzene-2,4,5,6-d4
Deuterated research standard
Sulfanitran-d4 (Major)
deuterated analytical reference standard
Almotriptan-d6 Hydrochloride
deuterated research reference standard
3-Diethylamino Acetaminophen-d10
Deuterated research compound
Clenpenterol-d5 Hydrochloride
Deuterated analytical reference standard
(6aR,9R)-7-methyl-N,N-bis(1,1,2,2,2-pentadeuterioethyl)-6,6a,8,9-tetrahydro-4H-indolo[4,3-fg]quinoline-9-carboxamide
VAYOSLLFUXYJDT-ABGPMOFUSA-N
[2H]C([2H])([2H])C([2H])([2H])N(C(=O)[C@H]1CN([C@@H]2CC3=CNC4=CC=CC(=C34)C2=C1)C)C([2H])([2H])C([2H])([2H])[2H]