This compound is a deuterated research reagent, specifically a stable isotope-labeled analog of 3-diethylamino acetaminophen. It is primarily used as an analytical standard or internal standard in mass spectrometry and other quantitative analytical methods.
콘텐츠 범위: 이 페이지의 정보는 화학물질 식별 및 산업 공급·연구개발·제조 맥락을 대상으로 합니다. 치료 효능 주장, 의료 조언 또는 의약품 사용 지침에 해당하지 않습니다.
이 화합물을 구매하거나 공급하시겠습니까?
재고를 등록하거나 구매 요청을 게시하세요
CAS 1794789-22-2
9-Amino-1,2,3,4-tetrahydroacridin-1-ol-d3
Deuterated research compound
( inverted exclamation markA)-Penbutolol-d9 (hydrochloride)
Deuterated research compound
2-BROMOBUTANE-D9
Deuterated research compound
1-Methylimidazole-d6
Deuterated research compound
Clenpenterol-d5 Hydrochloride
Deuterated analytical reference standard
Acetaminophen Dimer-d6
isotope-labeled research compound
2-Phenylbutyric Acid-d5 Methyl Ester
deuterated research standard
Aceclofenac-d4,13C2 (major)
Isotope-labeled analytical reference standard
N-[3-[[bis(1,1,2,2,2-pentadeuterioethyl)amino]methyl]-4-hydroxyphenyl]acetamide
BOUCRWJEKAGKKG-IZUSZFKNSA-N
[2H]C([2H])([2H])C([2H])([2H])N(CC1=C(C=CC(=C1)NC(=O)C)O)C([2H])([2H])C([2H])([2H])[2H]
—