2-Phenylbutyric Acid-d5 Methyl Ester is a deuterated research standard used as an analytical reference material. Its structure incorporates five deuterium atoms on the butyl side chain, making it valuable for quantification and tracing studies by mass spectrometry.
콘텐츠 범위: 이 페이지의 정보는 화학물질 식별 및 산업 공급·연구개발·제조 맥락을 대상으로 합니다. 치료 효능 주장, 의료 조언 또는 의약품 사용 지침에 해당하지 않습니다.
이 화합물을 구매하거나 공급하시겠습니까?
재고를 등록하거나 구매 요청을 게시하세요
CAS 1794940-35-4
Aceclofenac-d4,13C2 (major)
Isotope-labeled analytical reference standard
Dibenz[a,h]acridine-d6 (Major)
deuterated analytical reference standard
(2,5-difluorophenyl)methanesulfonyl Chloride
Research reagent
Trimethyl(tributylstannyl)silane
Organotin research reagent
methyl 3,3,4,4,4-pentadeuterio-2-phenylbutanoate
PPIQQNDMGXNRFA-WNWXXORZSA-N
[2H]C([2H])([2H])C([2H])([2H])C(C1=CC=CC=C1)C(=O)OC