2-Phenylbutyric Acid-d5 Methyl Ester is a deuterated research standard used as an analytical reference material. Its structure incorporates five deuterium atoms on the butyl side chain, making it valuable for quantification and tracing studies by mass spectrometry.
콘텐츠 범위: 이 페이지의 정보는 화학물질 식별 및 산업 공급·연구개발·제조 맥락을 대상으로 합니다. 치료 효능 주장, 의료 조언 또는 의약품 사용 지침에 해당하지 않습니다.
2-Phenylbutyric Acid-d5 Methyl Ester 구매를 찾고 계신가요?
구매 요청을 무료로 등록하세요. 계정이 필요 없습니다. 이 제품을 공급할 수 있는 공급업체에 전달되며, 답변은 이메일로 바로 받습니다.
Aceclofenac-d4,13C2 (major)
Isotope-labeled analytical reference standard
Dibenz[a,h]acridine-d6 (Major)
deuterated analytical reference standard
(2,5-difluorophenyl)methanesulfonyl Chloride
Research reagent
Trimethyl(tributylstannyl)silane
Organotin research reagent
methyl 3,3,4,4,4-pentadeuterio-2-phenylbutanoate
PPIQQNDMGXNRFA-WNWXXORZSA-N
[2H]C([2H])([2H])C([2H])([2H])C(C1=CC=CC=C1)C(=O)OC
2-Phenylbutyric Acid-d5 Methyl Ester 구매를 찾고 계신가요?
구매 요청을 무료로 등록하세요. 계정이 필요 없습니다. 이 제품을 공급할 수 있는 공급업체에 전달되며, 답변은 이메일로 바로 받습니다.