This compound is a deuterated form of penbutolol, presented as the hydrochloride salt. It is primarily used as a research reagent for analytical and metabolic studies involving the beta-blocker penbutolol.
콘텐츠 범위: 이 페이지의 정보는 화학물질 식별 및 산업 공급·연구개발·제조 맥락을 대상으로 합니다. 치료 효능 주장, 의료 조언 또는 의약품 사용 지침에 해당하지 않습니다.
( inverted exclamation markA)-Penbutolol-d9 (hydrochloride) 구매를 찾고 계신가요?
구매 요청을 무료로 등록하세요. 계정이 필요 없습니다. 이 제품을 공급할 수 있는 공급업체에 전달되며, 답변은 이메일로 바로 받습니다.
3-Diethylamino Acetaminophen-d10
Deuterated research compound
9-Amino-1,2,3,4-tetrahydroacridin-1-ol-d3
Deuterated research compound
2-BROMOBUTANE-D9
Deuterated research compound
1-Methylimidazole-d6
Deuterated research compound
2-Amino Nevirapine-d3
isotope-labeled research compound
Trans-Abacavir-d4 Hydrochloride
deuterated research standard
(R)-1-Aminoindane-d3 Hydrochloride
deuterated pharmaceutical research standard
3-bromo-2-methoxypyridine
research compound
1-(2-cyclopentylphenoxy)-3-[[1,1,1,3,3,3-hexadeuterio-2-(trideuteriomethyl)propan-2-yl]amino]propan-2-ol;hydrochloride
ITZWQFLTSRCDPC-KYRNGWDOSA-N
[2H]C([2H])([2H])C(C([2H])([2H])[2H])(C([2H])([2H])[2H])NCC(COC1=CC=CC=C1C2CCCC2)O.Cl
( inverted exclamation markA)-Penbutolol-d9 (hydrochloride) 구매를 찾고 계신가요?
구매 요청을 무료로 등록하세요. 계정이 필요 없습니다. 이 제품을 공급할 수 있는 공급업체에 전달되며, 답변은 이메일로 바로 받습니다.