1-Thianthrenylboronic Acid is a research reagent used in boronic acid chemistry. It contains varying amounts of anhydride and features a polycyclic structure with two aromatic rings and a heterocycle.
콘텐츠 범위: 이 페이지의 정보는 화학물질 식별 및 산업 공급·연구개발·제조 맥락을 대상으로 합니다. 치료 효능 주장, 의료 조언 또는 의약품 사용 지침에 해당하지 않습니다.
이 화합물 구매를 찾고 계신가요?
구매 요청을 무료로 등록하세요. 계정이 필요 없습니다. 이 제품을 공급할 수 있는 공급업체에 전달되며, 답변은 이메일로 바로 받습니다.
(S)-(-)-Valsartan-d8(valine-d8)
deuterated analytical reference standard
(2S)-1,1,2-triphenylethane-1,2-diol
research compound
Boron trifluoride etherate
NMR chemical shift reference compound
7-Methoxy-3-indolecarboxaldehyde
Research compound
Thianthren
research compound for phosphorescence studies
Thianthren-2-ylboronic acid
research chemical
thianthren-1-ylboronic acid
FZEWPLIHPXGNTB-UHFFFAOYSA-N
B(C1=C2C(=CC=C1)SC3=CC=CC=C3S2)(O)O
이 화합물 구매를 찾고 계신가요?
구매 요청을 무료로 등록하세요. 계정이 필요 없습니다. 이 제품을 공급할 수 있는 공급업체에 전달되며, 답변은 이메일로 바로 받습니다.