(2S)-1,1,2-triphenylethane-1,2-diol is a chiral organic compound featuring two alcohol groups and three aromatic rings. It is primarily supplied as a research reagent for laboratory and synthetic chemistry applications.
콘텐츠 범위: 이 페이지의 정보는 화학물질 식별 및 산업 공급·연구개발·제조 맥락을 대상으로 합니다. 치료 효능 주장, 의료 조언 또는 의약품 사용 지침에 해당하지 않습니다.
이 화합물을 구매하거나 공급하시겠습니까?
재고를 등록하거나 구매 요청을 게시하세요
CAS 108998-83-0
Boron trifluoride etherate
NMR chemical shift reference compound
7-Methoxy-3-indolecarboxaldehyde
Research compound
Fmoc-Pro-OSu
research reagent for peptide synthesis
3-(2-Methoxy-5-methylphenyl)-3-phenylpropanoic acid
research compound
(R)-(+)-2-hydroxy-1,2,2-triphenylethyl acetate
Pharmaceutical intermediate
1,2-Ethanediol, 1,1,2-triphenyl-, 2-acetate, (2S)-
research compound
(2S)-1,1,2-triphenylethane-1,2-diol
GWVWUZJOQHWMFB-IBGZPJMESA-N
C1=CC=C(C=C1)[C@@H](C(C2=CC=CC=C2)(C3=CC=CC=C3)O)O