Thianthren-2-ylboronic acid is a boronic acid derivative of thianthrene, a sulfur-containing heterocyclic compound. It is typically used as a research chemical in laboratory settings.
콘텐츠 범위: 이 페이지의 정보는 화학물질 식별 및 산업 공급·연구개발·제조 맥락을 대상으로 합니다. 치료 효능 주장, 의료 조언 또는 의약품 사용 지침에 해당하지 않습니다.
이 화합물을 구매하거나 공급하시겠습니까?
재고를 등록하거나 구매 요청을 게시하세요
CAS 108847-21-8
(S)-(-)-Valsartan-d8(valine-d8)
deuterated analytical reference standard
(2S)-1,1,2-triphenylethane-1,2-diol
research compound
Boron trifluoride etherate
NMR chemical shift reference compound
7-Methoxy-3-indolecarboxaldehyde
Research compound
1-Thianthrenylboronic Acid (contains varying amounts of Anhydride)
Research compound for boronic acid chemistry
Thianthren
research compound for phosphorescence studies
thianthren-2-ylboronic acid
GCSOJZMPHLRBMJ-UHFFFAOYSA-N
B(C1=CC2=C(C=C1)SC3=CC=CC=C3S2)(O)O