This compound is a deuterated analytical reference standard, specifically a stable isotope-labeled derivative of a tetrazole-containing carboxylic acid. Its primary significance lies in its use as a precisely labeled internal standard for quantitative analysis, enabling accurate measurement of the corresponding non-labeled compound in complex samples.
콘텐츠 범위: 이 페이지의 정보는 화학물질 식별 및 산업 공급·연구개발·제조 맥락을 대상으로 합니다. 치료 효능 주장, 의료 조언 또는 의약품 사용 지침에 해당하지 않습니다.
(S)-(-)-Valsartan-d8(valine-d8) 구매를 찾고 계신가요?
구매 요청을 무료로 등록하세요. 계정이 필요 없습니다. 이 제품을 공급할 수 있는 공급업체에 전달되며, 답변은 이메일로 바로 받습니다.
Alanine Valsartan
pharmaceutical impurity reference standard
(2S)-1,1,2-triphenylethane-1,2-diol
research compound
Boron trifluoride etherate
NMR chemical shift reference compound
7-Methoxy-3-indolecarboxaldehyde
Research compound
Fmoc-Pro-OSu
research reagent for peptide synthesis
(2S)-3-methyl-2-[2,2,3,3,4,4,5,5,5-nonadeuteriopentanoyl-[[4-[2-(2H-tetrazol-5-yl)phenyl]phenyl]methyl]amino]butanoic acid
pharmaceutical reference standard
발사르탄
active pharmaceutical ingredient
D-Valsartan
pharmaceutical impurity reference standard
(2S)-2,3,4,4,4-pentadeuterio-2-[pentanoyl-[[4-[2-(2H-tetrazol-5-yl)phenyl]phenyl]methyl]amino]-3-(trideuteriomethyl)butanoic acid
ACWBQPMHZXGDFX-KFWZLTATSA-N
[2H][C@@](C(=O)O)(C([2H])(C([2H])([2H])[2H])C([2H])([2H])[2H])N(CC1=CC=C(C=C1)C2=CC=CC=C2C3=NNN=N3)C(=O)CCCC
(S)-(-)-Valsartan-d8(valine-d8) 구매를 찾고 계신가요?
구매 요청을 무료로 등록하세요. 계정이 필요 없습니다. 이 제품을 공급할 수 있는 공급업체에 전달되며, 답변은 이메일로 바로 받습니다.