9,9-Dimethyl-9H-fluoren-2-amine is a research compound featuring a fluorene core with a dimethyl substituent at the 9-position and an amino group. It is primarily used in laboratory settings as a building block for chemical synthesis.
콘텐츠 범위: 이 페이지의 정보는 화학물질 식별 및 산업 공급·연구개발·제조 맥락을 대상으로 합니다. 치료 효능 주장, 의료 조언 또는 의약품 사용 지침에 해당하지 않습니다.
9,9-dimethyl-9H-fluoren-2-amine 구매를 찾고 계신가요?
구매 요청을 무료로 등록하세요. 계정이 필요 없습니다. 이 제품을 공급할 수 있는 공급업체에 전달되며, 답변은 이메일로 바로 받습니다.
Dibenzothiophene-4-boronic acid
boronic acid research reagent
Thianthren-2-ylboronic acid
research chemical
1-Thianthrenylboronic Acid (contains varying amounts of Anhydride)
Research compound for boronic acid chemistry
(S)-(-)-Valsartan-d8(valine-d8)
deuterated analytical reference standard
9,9-dimethylfluoren-2-amine
GUTJITRKAMCHSD-UHFFFAOYSA-N
CC1(C2=CC=CC=C2C3=C1C=C(C=C3)N)C
9,9-dimethyl-9H-fluoren-2-amine 구매를 찾고 계신가요?
구매 요청을 무료로 등록하세요. 계정이 필요 없습니다. 이 제품을 공급할 수 있는 공급업체에 전달되며, 답변은 이메일로 바로 받습니다.