DL-Malic acid-2,3,3-d3 is a deuterium-labeled form of malic acid, where three hydrogen atoms are replaced with deuterium. It is primarily used as an internal standard in analytical chemistry for the quantification of malic acid via mass spectrometry.
콘텐츠 범위: 이 페이지의 정보는 화학물질 식별 및 산업 공급·연구개발·제조 맥락을 대상으로 합니다. 치료 효능 주장, 의료 조언 또는 의약품 사용 지침에 해당하지 않습니다.
DL-Malic acid-2,3,3-d3 구매를 찾고 계신가요?
구매 요청을 무료로 등록하세요. 계정이 필요 없습니다. 이 제품을 공급할 수 있는 공급업체에 전달되며, 답변은 이메일로 바로 받습니다.
5-bromo-2-hydroxynicotinic acid
research reagent
(R)-1-Methyl-3-pyrrolidinol
Research reagent
Ethylmagnesium iodide
Grignard reagent
3-(1-(5-Ethylpyrimidin-2-yl)piperidin-4-yl)propan-1-ol
research compound
(S)-Malic acid-d3
deuterated analytical reference standard
Malic acid
Food acidity regulator and flavoring agent
D-(+)-malic acid
food additive and buffering agent
Malic acid
food acidity regulator and flavoring
2,2,3-trideuterio-3-hydroxybutanedioic acid
BJEPYKJPYRNKOW-FUDHJZNOSA-N
[2H]C([2H])(C(=O)O)C([2H])(C(=O)O)O
DL-Malic acid-2,3,3-d3 구매를 찾고 계신가요?
구매 요청을 무료로 등록하세요. 계정이 필요 없습니다. 이 제품을 공급할 수 있는 공급업체에 전달되며, 답변은 이메일로 바로 받습니다.