Dibenzo[b,d]furan-d8 is a deuterated analytical standard used primarily in research and laboratory settings. Its structure features a fully deuterated tricyclic aromatic ring system, making it valuable for mass spectrometry and nuclear magnetic resonance applications.
Content scope: Information here supports chemical identification and industrial supply, research, and manufacturing contexts. It is not a therapeutic claim, medical advice, or drug-use instructions.
Sourcing or supplying this compound?
List your inventory or post a purchase request
CAS 93952-04-6
(2E)-3-(²H₅)Phenyl(²H₂)prop-2-enoic acid
research compound
Dimethyl succinate-2,2,3,3-d4
research compound
Di((2H3)methyl)ammonium chloride
research compound
Propane-1,1,1,2,3,3-d6, 2,3-dichloro-
research compound
Dibutyl (²H₄)benzene-1,2-dicarboxylate
research compound
Diethyl (²H₄)benzene-1,2-dicarboxylate
research compound
P,p'-DDT-d8
research compound
Dibenzofuran
Component of heat-transfer oils
1,2,3,4,6,7,8,9-octadeuteriodibenzofuran
TXCDCPKCNAJMEE-PGRXLJNUSA-N
[2H]C1=C(C(=C2C(=C1[2H])C3=C(C(=C(C(=C3O2)[2H])[2H])[2H])[2H])[2H])[2H]