Dotam-mono acid is a research reagent and chelating ligand derived from a tetraazacyclododecane macrocycle. Its structure features three amide groups and one carboxylic acid group, enabling it to bind metal ions for coordination chemistry studies.
Content scope: Information here supports chemical identification and industrial supply, research, and manufacturing contexts. It is not a therapeutic claim, medical advice, or drug-use instructions.
Sourcing or supplying this compound?
List your inventory or post a purchase request
CAS 913528-04-8
Tetraxetan
pharmaceutical raw material
(p-scn-bn)-dota
research compound
P-SCN-Bn-TCMC
research compound
1-(1-benzothiophen-4-yl)piperazine hydrochloride
research compound
Methyl 4-chloro-3-methylbenzoate
research compound
(2S)-N-[(2R)-3,3-dimethylbutan-2-yl]-3,3-dimethyl-2-[(1-methylimidazol-2-yl)methylamino]butanamide
research compound
(2-Bromo-6-fluorophenyl)boronic acid
research compound
Gadoterate meglumine
pharmaceutical raw material
2-[4,7,10-tris(2-amino-2-oxoethyl)-1,4,7,10-tetrazacyclododec-1-yl]acetic acid
DFPHZEYJGWLQJE-UHFFFAOYSA-N
C1CN(CCN(CCN(CCN1CC(=O)N)CC(=O)N)CC(=O)O)CC(=O)N