Decanoic-d19 acid is a deuterated form of decanoic acid where all nineteen hydrogen atoms are replaced with deuterium. It is primarily used as a research reference standard in analytical chemistry and mass spectrometry.
Content scope: Information here supports chemical identification and industrial supply, research, and manufacturing contexts. It is not a therapeutic claim, medical advice, or drug-use instructions.
Sourcing or supplying this compound?
List your inventory or post a purchase request
CAS 88170-22-3
(²H₁₅)Octanoic acid
research compound
(²H₁₁)Hexanoic acid
research compound
(²H₉)Pentanoic acid
research compound
(+/-)-Mandelic-2,3,4,5,6-d5 Acid
research compound
Rabeprazole D4
research compound
2,6-DIMETHYLNAPHTHALENE-D12
research compound
1-Bromo(²H₅)benzene
research compound
6-Chloro-4-phenyl-1,4-dihydroquinazoline-2-carboxylic acid
research compound
2,2,3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,10-nonadecadeuteriodecanoic acid
GHVNFZFCNZKVNT-KIJKOTCYSA-N
[2H]C([2H])([2H])C([2H])([2H])C([2H])([2H])C([2H])([2H])C([2H])([2H])C([2H])([2H])C([2H])([2H])C([2H])([2H])C([2H])([2H])C(=O)O