POPSO is a zwitterionic sulfonic acid compound commonly used as a biological buffer reagent in biochemical and molecular biology research. Its structure contains two hydroxyl and two sulfonic acid groups, providing effective buffering capacity in physiological pH ranges.
Content scope: Information here supports chemical identification and industrial supply, research, and manufacturing contexts. It is not a therapeutic claim, medical advice, or drug-use instructions.
Sourcing or supplying this compound?
List your inventory or post a purchase request
CAS 68189-43-5
HEPPSO
research compound
2-Hydroxy-3-morpholinopropanesulfonic acid
research compound
N-(Tris(hydroxymethyl)methyl)-2-aminoethanesulfonic acid sodium salt
research compound
MOPS sodium salt
research compound
3-(Cyclohexylamino)-2-hydroxy-1-propanesulfonic acid
research compound
N-(2-Acetamido)iminodiacetic acid monosodium salt
research compound
2-Bromo-6-chlorothieno[2,3-b]pyridine
research compound
3,5-Dichloro-6-methylpyridazine
research compound
2-hydroxy-3-[4-(2-hydroxy-3-sulfopropyl)piperazin-1-yl]propane-1-sulfonic acid
LVQFQZZGTZFUNF-UHFFFAOYSA-N
C1CN(CCN1CC(CS(=O)(=O)O)O)CC(CS(=O)(=O)O)O