This compound is a chemical compound forming a sodium salt of a tetrazole derivative. It is typically used as a laboratory reagent or research compound in chemical synthesis due to its heterocyclic structure containing an alcohol group and a thiolate moiety.
Content scope: Information here supports chemical identification and industrial supply, research, and manufacturing contexts. It is not a therapeutic claim, medical advice, or drug-use instructions.
Sourcing or supplying this compound?
List your inventory or post a purchase request
CAS 64350-77-2
Tetrakis(acetonitrile)copper(I) hexafluorophosphate
laboratory reagent
Chromium nicotinate
research reagent
Dipentyl succinate
chemical intermediate
(6-Chloropyridin-3-yl)(morpholin-4-yl)methanone
research reagent
2-(5-Mercaptotetrazole-1-yl)ethanol
research compound
Disodium 2,5-dihydro-5-thiooxo-1H-tetrazol-1-ylmethanesulfonate
research compound
16-(2H-Tetrazol-5-yl)hexadecanoic acid
pharmaceutical intermediate
5-(Ethylthio)-1H-tetrazole
research compound
sodium 1-(2-hydroxyethyl)tetrazole-5-thiolate
AQPXGOATMZTDJA-UHFFFAOYSA-M
C(CO)N1C(=NN=N1)[S-].[Na+]