4-(4-Pyridyl)benzoic acid is a research compound featuring a pyridine ring attached to a benzoic acid moiety. It is primarily used as a reagent in coordination chemistry and materials science research.
Content scope: Information here supports chemical identification and industrial supply, research, and manufacturing contexts. It is not a therapeutic claim, medical advice, or drug-use instructions.
Sourcing or supplying this compound?
List your inventory or post a purchase request
CAS 4385-76-6
Isonicotinic acid
Metabolite
3-(pyridin-3-yl)benzoic acid
research compound
(S)-4-(4,7-Bis(2-(tert-butoxy)-2-oxoethyl)-1,4,7-triazonan-1-yl)-5-(tert-butoxy)-5-oxopentanoic acid
research compound
6-Trifluoromethylpyridine-3,4-diamine
research compound
2-amino-6-methylbenzoic acid
research compound
3-(pyridin-4-yl)benzoic acid
research compound
2,6-Dimethyl-4-(2'-nitrosophenyl)-3,5-pyridinedicarboxylic acid dimethyl ester
Nitrosamine impurity standard
Dehydro nimodipine
pharmaceutical intermediate
4-pyridin-4-ylbenzoic acid
DZLGZIGLHCRIMF-UHFFFAOYSA-N
C1=CC(=CC=C1C2=CC=NC=C2)C(=O)O