Decafluorobiphenyl is a highly fluorinated biphenyl derivative widely employed as a research intermediate in organic synthesis. Its perfluorinated aromatic rings contribute to unique chemical stability and physical properties, making it valuable in the development of advanced fluorinated materials and building blocks.
Content scope: Information here supports chemical identification and industrial supply, research, and manufacturing contexts. It is not a therapeutic claim, medical advice, or drug-use instructions.
Sourcing or supplying this compound?
List your inventory or post a purchase request
CAS 434-90-2
Bis[2-(dicyclohexylphosphino)phenyl] ether
research compound
5-Formyl-2-thiopheneboronic acid
research compound
3-Bromo-5-(trifluoromethyl)pyridine
research compound
5-Fluorothiophen-2-carboxylic acid
research compound
1,2,3,4,5-pentafluoro-6-(2,3,4,5,6-pentafluorophenyl)benzene
ONUFSRWQCKNVSL-UHFFFAOYSA-N
C1(=C(C(=C(C(=C1F)F)F)F)F)C2=C(C(=C(C(=C2F)F)F)F)F