This compound is a boronic acid research reagent that contains varying amounts of anhydride. It features a quinoline ring system with a boronic acid functional group, making it useful in synthetic chemistry investigations.
Content scope: Information here supports chemical identification and industrial supply, research, and manufacturing contexts. It is not a therapeutic claim, medical advice, or drug-use instructions.
Sourcing or supplying this compound?
List your inventory or post a purchase request
CAS 376581-24-7
3-Methylthiophene-2-boronic acid
research compound
5-Cyanothiophene-2-boronic acid
research compound
Cyclopropylboronic acid
research compound
Pentylboronic acid
research compound
Pyrazole-3-boronic acid
research compound
2'-methoxy-3'-nitrobiphenyl-3-carboxylic acid
research compound
2'-Hydroxy-3'-nitro[1,1'-biphenyl]-3-carboxylic acid
research compound
3'-Amino-2'-hydroxy[1,1'-biphenyl]-3-carboxylic acid--hydrogen chloride (1/1)
research compound
quinolin-6-ylboronic acid
JLOLSBLXNMVKGY-UHFFFAOYSA-N
B(C1=CC2=C(C=C1)N=CC=C2)(O)O