This compound is an aromatic ether that serves as a flavor and fragrance ingredient, characterized by a benzene ring and two ether groups. It is primarily used to impart scents and flavors in consumer products.
Geltungsbereich: Die Informationen auf dieser Seite betreffen die Identifizierung von Chemikalien sowie industrielle Liefer-, Forschungs- und Produktionskontexte. Sie stellen keine Heilversprechen, medizinische Beratung oder Anwendungshinweise für Arzneimittel dar.
Beschaffen oder liefern Sie diese Verbindung?
Inventar einstellen oder Kaufanfrage stellen
CAS 7148-78-9
3,5-Dimethoxybenzaldehyde
Flavor and fragrance intermediate
2-Ethylhexanethiol
Flavoring agent
Butyl sorbate
Flavor and fragrance ingredient
Ethyl 2-methylbutyrate
flavor and fragrance ingredient
[(E)-3,3-diethoxyprop-1-enyl]benzene
VYKDEWVAUWARRX-ZHACJKMWSA-N
CCOC(/C=C/C1=CC=CC=C1)OCC