Dideoxy GTP is a dideoxynucleotide triphosphate used as a chain-terminating inhibitor in the Sanger method of DNA sequencing. It lacks hydroxyl groups at the 2' and 3' positions of the ribose sugar, preventing further DNA strand elongation by DNA polymerase.
Geltungsbereich: Die Informationen auf dieser Seite betreffen die Identifizierung von Chemikalien sowie industrielle Liefer-, Forschungs- und Produktionskontexte. Sie stellen keine Heilversprechen, medizinische Beratung oder Anwendungshinweise für Arzneimittel dar.
Beschaffen oder liefern Sie diese Verbindung?
Inventar einstellen oder Kaufanfrage stellen
CAS 68726-28-3
3'-amino-2',3'-dideoxyguanosine 5'-(tetrahydrogen triphosphate)
Nucleotide analogue research reagent
DdATP
DNA sequencing reagent
Boc-2-aminobenzoic acid
research compound
5-Bromo-4,6-dichloropyrimidine
Research chemical intermediate
Ethylenediaminetriacetic acid
chelating agent
4-Methoxy-3-methylbenzoic Acid
research compound
[[(5R)-5-(2-amino-6-oxo-1H-purin-9-yl)oxolan-2-yl]methoxy-hydroxyphosphoryl] phosphono hydrogen phosphate
HDRRAMINWIWTNU-PRJDIBJQSA-N
C1CC(O[C@H]1N2C=NC3=C2N=C(NC3=O)N)COP(=O)(O)OP(=O)(O)OP(=O)(O)O