3'-amino-2',3'-dideoxyguanosine 5'-(tetrahydrogen triphosphate) is a modified nucleotide analogue used in biochemical research. Its structure features a guanine base attached to a deoxyribose sugar with an amino group at the 3' position and a triphosphate chain, making it a valuable tool for studying nucleic acid synthesis and enzyme mechanisms.
Geltungsbereich: Die Informationen auf dieser Seite betreffen die Identifizierung von Chemikalien sowie industrielle Liefer-, Forschungs- und Produktionskontexte. Sie stellen keine Heilversprechen, medizinische Beratung oder Anwendungshinweise für Arzneimittel dar.
Beschaffen oder liefern Sie diese Verbindung?
Inventar einstellen oder Kaufanfrage stellen
CAS 90053-19-3
Guanosine 5'-(tetrahydrogen triphosphate), 2'-deoxy-, trisodium salt
nucleotide triphosphate intermediate
DGTP
research compound
Dideoxy GTP
DNA sequencing reagent
JI-101
research compound
(S)-Methyl 2-((S)-2-amino-4-methylpentanamido)-3-phenylpropanoate 2,2,2-trifluoroacetate
research compound
1-Phenyl-d5-ethanol
deuterated research standard
(2-ethylhexyl)magnesium bromide
Grignard reagent for organic synthesis
[[(2S,3S,5R)-3-amino-5-(2-amino-6-oxo-1H-purin-9-yl)oxolan-2-yl]methoxy-hydroxyphosphoryl] phosphono hydrogen phosphate
ILTYANYMUGEMNF-KVQBGUIXSA-N
C1[C@@H]([C@H](O[C@H]1N2C=NC3=C2N=C(NC3=O)N)COP(=O)(O)OP(=O)(O)OP(=O)(O)O)N