Boc-2-aminobenzoic acid is a research compound featuring a tert-butoxycarbonyl (Boc) protecting group attached to the amino group of 2-aminobenzoic acid. It is primarily used in organic synthesis and pharmaceutical research as a building block for more complex molecules.
Geltungsbereich: Die Informationen auf dieser Seite betreffen die Identifizierung von Chemikalien sowie industrielle Liefer-, Forschungs- und Produktionskontexte. Sie stellen keine Heilversprechen, medizinische Beratung oder Anwendungshinweise für Arzneimittel dar.
Beschaffen oder liefern Sie diese Verbindung?
Inventar einstellen oder Kaufanfrage stellen
CAS 68790-38-5
5-Bromo-4,6-dichloropyrimidine
Research chemical intermediate
Ethylenediaminetriacetic acid
chelating agent
4-Methoxy-3-methylbenzoic Acid
research compound
Rhodium(II) 2,2,2-triphenylacetate
research compound for catalysis
2-[(2-methylpropan-2-yl)oxycarbonylamino]benzoic acid
BYGHHEDJDSLEKK-UHFFFAOYSA-N
CC(C)(C)OC(=O)NC1=CC=CC=C1C(=O)O