ddATP is a dideoxynucleotide triphosphate, a synthetic analog of natural ATP, that acts as a chain-terminating inhibitor of DNA polymerase. It is a key reagent in the Sanger method of DNA sequencing, where its incorporation into a growing DNA strand prevents further elongation.
Geltungsbereich: Die Informationen auf dieser Seite betreffen die Identifizierung von Chemikalien sowie industrielle Liefer-, Forschungs- und Produktionskontexte. Sie stellen keine Heilversprechen, medizinische Beratung oder Anwendungshinweise für Arzneimittel dar.
Beschaffen oder liefern Sie diese Verbindung?
Inventar einstellen oder Kaufanfrage stellen
CAS 24027-80-3
3'-Amino-3'-dATP
nucleotide research reagent
Dideoxy GTP
DNA sequencing reagent
2-(DIPHENYLPHOSPHINO)-2'-(N,N-DIMETHYLAMINO)BIPHENYL
Ligand for cross-coupling reactions
Pyridinium p-toluenesulfonate
Organocatalyst for chemical synthesis
4-Nitrophenylboronic acid
research compound for organic synthesis
3-[4-({2-[(2,3-dihydro-1H-inden-5-yl)amino]pyrimidin-4-yl}amino)-1-oxo-2,3-dihydro-1H-isoindol-2-yl]piperidine-2,6-dione
research compound
DdATP trisodium
Nucleotide analog research reagent
[[(2S,5R)-5-(6-aminopurin-9-yl)oxolan-2-yl]methoxy-hydroxyphosphoryl] phosphono hydrogen phosphate
OAKPWEUQDVLTCN-NKWVEPMBSA-N
C1C[C@@H](O[C@@H]1COP(=O)(O)OP(=O)(O)OP(=O)(O)O)N2C=NC3=C(N=CN=C32)N