3-(Methoxycarbonyl)benzeneboronic Acid is a boronic acid reagent used primarily in chemical synthesis. It features an aromatic ring with an ester functional group and two hydroxyl groups on the boron atom, making it suitable for cross-coupling reactions and related laboratory applications.
نطاق المحتوى: تتعلق المعلومات الواردة في هذه الصفحة بتحديد المواد الكيميائية وبسياقات التوريد الصناعي والبحث والإنتاج. وهي لا تشكّل ادعاءً علاجياً أو نصيحة طبية أو إرشادات لاستخدام الأدوية.
هل تبحث عن شراء 3-(Methoxycarbonyl)benzeneboronic Acid؟
انشر طلب شراء مجانًا — دون الحاجة إلى حساب. يصل الطلب إلى مورّدي هذا المنتج، وتصلك الردود مباشرة عبر بريدك الإلكتروني.
(prop-1-en-2-yl)boronic acid
boronic acid reagent for synthesis
5-Chlorothiophene-2-boronic acid
boronic acid reagent for synthesis
3,5-Dichlorophenylboronic acid
boronic acid reagent for synthesis
2-Butoxyphenylboronic acid
boronic acid reagent for synthesis
L-Dilinoleoyllecithin
research compound
TERT-BUTYLBORONIC ACID PINACOL ESTER
research compound for boron chemistry
Arginyl-glycyl-aspartic acid
cell adhesion research tool
2-Chloro-5-Methoxypyrimidin-4-Amine
research chemical
(3-methoxycarbonylphenyl)boronic acid
ALTLCJHSJMGSLT-UHFFFAOYSA-N
B(C1=CC(=CC=C1)C(=O)OC)(O)O
هل تبحث عن شراء 3-(Methoxycarbonyl)benzeneboronic Acid؟
انشر طلب شراء مجانًا — دون الحاجة إلى حساب. يصل الطلب إلى مورّدي هذا المنتج، وتصلك الردود مباشرة عبر بريدك الإلكتروني.