3,5-Dichlorophenylboronic acid is a boronic acid reagent used in organic synthesis. Its structure features an aromatic ring with two chlorine substituents and a boronic acid group, making it useful for carbon-carbon bond formation reactions such as Suzuki coupling.
نطاق المحتوى: تتعلق المعلومات الواردة في هذه الصفحة بتحديد المواد الكيميائية وبسياقات التوريد الصناعي والبحث والإنتاج. وهي لا تشكّل ادعاءً علاجياً أو نصيحة طبية أو إرشادات لاستخدام الأدوية.
هل تشتري أو تورد هذا المركب؟
أضف مخزونك أو أنشر طلب شراء
CAS 67492-50-6
2-Butoxyphenylboronic acid
boronic acid reagent for synthesis
5-Bromo-2-methoxypyridine-4-boronic acid
boronic acid reagent for synthesis
3-(Methoxycarbonyl)benzeneboronic Acid
boronic acid reagent for synthesis
(prop-1-en-2-yl)boronic acid
boronic acid reagent for synthesis
METHYLMAGNESIUM CHLORIDE
Grignard reagent for organic synthesis
4-Azidopuromycin
research compound
N-Acetyl-D-mannosamine hydrate
Biochemical research reagent
(4,4'-Di-tert-butyl-2,2'-bipyridine)bis[(2-pyridinyl)phenyl]iridium(III) Hexafluorophosphate
phosphorescent organic light-emitting diode material
(3,5-dichlorophenyl)boronic acid
DKYRKAIKWFHQHM-UHFFFAOYSA-N
B(C1=CC(=CC(=C1)Cl)Cl)(O)O