This compound is a chiral phosphine ligand used in asymmetric catalysis. It features a binaphthyl backbone with multiple aromatic rings and zero polar surface area, reflecting its nonpolar character.
نطاق المحتوى: تتعلق المعلومات الواردة في هذه الصفحة بتحديد المواد الكيميائية وبسياقات التوريد الصناعي والبحث والإنتاج. وهي لا تشكّل ادعاءً علاجياً أو نصيحة طبية أو إرشادات لاستخدام الأدوية.
هل تشتري أو تورد هذا المركب؟
أضف مخزونك أو أنشر طلب شراء
CAS 99646-28-3
2,2'-Bis(di-p-tolylphosphino)-1,1'-binaphthyl
chiral phosphine ligand for catalysis
[RUCL(P-CYMENE)((R)-TOLBINAP)]CL
asymmetric hydrogenation catalyst
(S)-Ru(OAc)2(T-BINAP)
chiral catalyst for asymmetric synthesis
(S)-Ru(OAc)2(T-BINAP)
asymmetric hydrogenation catalyst
Chloro[(S)-2,2'-bis(bis(3,5-dimethylphenyl)phosphino)-1,1'-binaphthyl](p-cymene)ruthenium(II) chloride
asymmetric hydrogenation catalyst
(R)-[2,2'-Bis(diphenylphosphino)-1,1'-binaphthyl dichlororuthenium
asymmetric hydrogenation catalyst
(S)-RuCl[(p-cymene(BINAP)Cl
asymmetric hydrogenation catalyst
(S)-(+)-1-[(R)-2-(DICYCLOHEXYLPHOSPHINO)FERROCENYL]ETHYLDIPHENYLPHOSPHINE
chiral phosphine ligand for asymmetric catalysis
[1-[2-bis(4-methylphenyl)phosphanylnaphthalen-1-yl]naphthalen-2-yl]-bis(4-methylphenyl)phosphane
IOPQYDKQISFMJI-UHFFFAOYSA-N
CC1=CC=C(C=C1)P(C2=CC=C(C=C2)C)C3=C(C4=CC=CC=C4C=C3)C5=C(C=CC6=CC=CC=C65)P(C7=CC=C(C=C7)C)C8=CC=C(C=C8)C