This compound is a chiral phosphine ligand used in catalytic applications. It is a research reagent designed for use in asymmetric catalysis, where it coordinates to metals to facilitate stereoselective reactions.
نطاق المحتوى: تتعلق المعلومات الواردة في هذه الصفحة بتحديد المواد الكيميائية وبسياقات التوريد الصناعي والبحث والإنتاج. وهي لا تشكّل ادعاءً علاجياً أو نصيحة طبية أو إرشادات لاستخدام الأدوية.
هل تشتري أو تورد هذا المركب؟
أضف مخزونك أو أنشر طلب شراء
CAS 100165-88-6
[RUCL(P-CYMENE)((R)-TOLBINAP)]CL
asymmetric hydrogenation catalyst
(S)-Ru(OAc)2(T-BINAP)
chiral catalyst for asymmetric synthesis
(S)-Ru(OAc)2(T-BINAP)
asymmetric hydrogenation catalyst
Chloro((S)-(-)-2,2'-bis(di-p-tolylphosphino)-1,1'-binaphthyl)(p-cymene)ruthenium(II) chloride (RuCl(p-cymene)((S)-tolbinap))Cl
Asymmetric hydrogenation catalyst
(R)-(+)-2,2'-BIS[DI(3,5-XYLYL)PHOSPHINO]-1,1'-BINAPHTHYL
chiral phosphine ligand for catalysis
(R,R)-2,7-DI-TERT-BUTYL-9,9-DIMETHYL-4,5-BIS(METHYLPHENYLPHOSPHINO)XANTHENE
chiral phosphine ligand for catalysis
8-Aminooctanoic acid
research reagent for expanded genetic code
1,3-Bis(dicyclohexylphosphino)propane bis(tetrafluoroborate)
phosphonium salt reagent
[1-[2-bis(4-methylphenyl)phosphanylnaphthalen-1-yl]naphthalen-2-yl]-bis(4-methylphenyl)phosphane
IOPQYDKQISFMJI-UHFFFAOYSA-N
CC1=CC=C(C=C1)P(C2=CC=C(C=C2)C)C3=C(C4=CC=CC=C4C=C3)C5=C(C=CC6=CC=CC=C65)P(C7=CC=C(C=C7)C)C8=CC=C(C=C8)C