4-Bromobenzenesulfonyl chloride is a chemical compound commonly employed as a reagent in organic synthesis. It features an aromatic ring substituted with both a bromine atom and a sulfonyl chloride group.
نطاق المحتوى: تتعلق المعلومات الواردة في هذه الصفحة بتحديد المواد الكيميائية وبسياقات التوريد الصناعي والبحث والإنتاج. وهي لا تشكّل ادعاءً علاجياً أو نصيحة طبية أو إرشادات لاستخدام الأدوية.
هل تشتري أو تورد هذا المركب؟
أضف مخزونك أو أنشر طلب شراء
CAS 98-58-8
2-Ethylhexyl chloroformate
Reagent for organic synthesis
4-Methoxybenzenesulfonyl chloride
Sulfonyl chloride reagent for synthesis
4-tert-Butylbenzoic acid
alkyd resin modifier and corrosion inhibitor
Piperidinium piperidine-1-carbodithioate
rubber accelerator
CUMENE
Production of phenol and acetone
4-bromobenzenesulfonyl chloride
KMMHZIBWCXYAAH-UHFFFAOYSA-N
C1=CC(=CC=C1S(=O)(=O)Cl)Br