4-Methoxybenzenesulfonyl chloride is an organic compound featuring a sulfonyl chloride group attached to a methoxy-substituted aromatic ring. Its primary significance is as a sulfonyl chloride reagent used in organic synthesis.
نطاق المحتوى: تتعلق المعلومات الواردة في هذه الصفحة بتحديد المواد الكيميائية وبسياقات التوريد الصناعي والبحث والإنتاج. وهي لا تشكّل ادعاءً علاجياً أو نصيحة طبية أو إرشادات لاستخدام الأدوية.
هل تشتري أو تورد هذا المركب؟
أضف مخزونك أو أنشر طلب شراء
CAS 98-68-0
4-tert-Butylbenzoic acid
alkyd resin modifier and corrosion inhibitor
Piperidinium piperidine-1-carbodithioate
rubber accelerator
CUMENE
Production of phenol and acetone
Alpha-Methylstyrene
polymerization monomer comonomer
4-methoxybenzenesulfonyl chloride
DTJVECUKADWGMO-UHFFFAOYSA-N
COC1=CC=C(C=C1)S(=O)(=O)Cl