This compound is a salt-like research reagent consisting of a boroxine derivative coordinated with pyridine. It is primarily used in boroxine chemistry for laboratory studies and material synthesis.
نطاق المحتوى: تتعلق المعلومات الواردة في هذه الصفحة بتحديد المواد الكيميائية وبسياقات التوريد الصناعي والبحث والإنتاج. وهي لا تشكّل ادعاءً علاجياً أو نصيحة طبية أو إرشادات لاستخدام الأدوية.
هل تشتري أو تورد هذا المركب؟
أضف مخزونك أو أنشر طلب شراء
CAS 95010-17-6
L-Serine-d2
isotopically labeled research compound
1,2-Ethanediol, 1,1,2-triphenyl-, 2-acetate, (2S)-
research compound
Ethyl 5-(hydroxymethyl)-3-phenylisoxazole-4-carboxylate
research compound
Magnesium bromide 3-methylthiophen-2-ide (1/1/1)
research reagent for synthesis
pyridine;2,4,6-tris(ethenyl)-1,3,5,2,4,6-trioxatriborinane
YLHJACXHRQQNQR-UHFFFAOYSA-N
B1(OB(OB(O1)C=C)C=C)C=C.C1=CC=NC=C1