L-Serine-d2 is a isotopically labeled research compound, specifically a deuterated form of the amino acid L-serine. It is primarily used as an internal standard or tracer in laboratory studies, particularly in metabolic and analytical research.
نطاق المحتوى: تتعلق المعلومات الواردة في هذه الصفحة بتحديد المواد الكيميائية وبسياقات التوريد الصناعي والبحث والإنتاج. وهي لا تشكّل ادعاءً علاجياً أو نصيحة طبية أو إرشادات لاستخدام الأدوية.
هل تشتري أو تورد هذا المركب؟
أضف مخزونك أو أنشر طلب شراء
CAS 95034-57-4
2-NP-SCA 13C,15N2
isotopically labeled research compound
Nitrobenzene-(1)(3)C
isotopically labeled research compound
2,4,6-Trichlorophen-3,5-d2-ol
isotopically labeled research compound
P,p'-DDD-d8
isotopically labeled research compound
1,2-Ethanediol, 1,1,2-triphenyl-, 2-acetate, (2S)-
research compound
Ethyl 5-(hydroxymethyl)-3-phenylisoxazole-4-carboxylate
research compound
Magnesium bromide 3-methylthiophen-2-ide (1/1/1)
research reagent for synthesis
Acetophenone, 2-phenyl-, oxime
research compound
(2S)-2-amino-3,3-dideuterio-3-hydroxypropanoic acid
MTCFGRXMJLQNBG-XFJCSJJYSA-N
[2H]C([2H])([C@@H](C(=O)O)N)O