This compound is the hydrochloride salt of 2-ethylbutyl (2S)-2-aminopropanoate, a chiral amino acid ester. It serves as an intermediate in the production of the antiviral compound remdesivir.
نطاق المحتوى: تتعلق المعلومات الواردة في هذه الصفحة بتحديد المواد الكيميائية وبسياقات التوريد الصناعي والبحث والإنتاج. وهي لا تشكّل ادعاءً علاجياً أو نصيحة طبية أو إرشادات لاستخدام الأدوية.
هل تشتري أو تورد هذا المركب؟
أضف مخزونك أو أنشر طلب شراء
CAS 946511-97-3
Ethyl 2-[4-(Boc-amino)cyclohexyl]acetate
Pharmaceutical intermediate with Boc-protected amine
2,3,4,5-Tetrafluorobenzoyl chloride
Pharmaceutical intermediate for synthesis
Ethyl 3-oxo-(2,3,4,5-tetrafluorophenyl)propanoate
Pharmaceutical intermediate for synthesis
2,2-Diphenylacetaldehyde
pharmaceutical intermediate synthesis
2-ethylbutyl (2S)-2-aminopropanoate;hydrochloride
DEAGOVGXNPHPIJ-FJXQXJEOSA-N
CCC(CC)COC(=O)[C@H](C)N.Cl