2,3,4,5-Tetrafluorobenzoyl chloride is a fluorinated aromatic acyl chloride used as a pharmaceutical intermediate. It serves as a building block in the synthesis of active pharmaceutical ingredients due to its reactive carbonyl chloride group and multiple fluorine substituents.
نطاق المحتوى: تتعلق المعلومات الواردة في هذه الصفحة بتحديد المواد الكيميائية وبسياقات التوريد الصناعي والبحث والإنتاج. وهي لا تشكّل ادعاءً علاجياً أو نصيحة طبية أو إرشادات لاستخدام الأدوية.
هل تشتري أو تورد هذا المركب؟
أضف مخزونك أو أنشر طلب شراء
CAS 94695-48-4
Ethyl 3-oxo-(2,3,4,5-tetrafluorophenyl)propanoate
Pharmaceutical intermediate for synthesis
2,2-Diphenylacetaldehyde
pharmaceutical intermediate synthesis
Tert-Butyl trans-4-ethynylcyclohexylcarbamate
Pharmaceutical intermediate
N-a-Fmoc-a-aminoisobutyric acid, N-fmoc-c-a-methylalanine
peptide synthesis building block
2,3,4,5-tetrafluorobenzoyl chloride
XWCKIXLTBNGIHV-UHFFFAOYSA-N
C1=C(C(=C(C(=C1F)F)F)F)C(=O)Cl