Ethyl 4-(butylamino)benzoate is a chemical compound used as a pharmaceutical intermediate. It features an aromatic ring with an ester and an amine functional group, making it suitable for incorporation into more complex drug molecules during synthesis.
نطاق المحتوى: تتعلق المعلومات الواردة في هذه الصفحة بتحديد المواد الكيميائية وبسياقات التوريد الصناعي والبحث والإنتاج. وهي لا تشكّل ادعاءً علاجياً أو نصيحة طبية أو إرشادات لاستخدام الأدوية.
هل تشتري أو تورد هذا المركب؟
أضف مخزونك أو أنشر طلب شراء
CAS 94-32-6
5-Chlorobenzotriazole
peptide coupling reagent intermediate
2-Amino-N-(2-(2-chlorobenzoyl)-4-nitrophenyl)acetamide hydrochloride
Pharmaceutical intermediate
(R)-2-(4-Hydroxyphenoxy)propanoic acid
Pharmaceutical intermediate for herbicide synthesis
(2S,3aS,7aS)-Benzyl octahydro-1H-indole-2-carboxylate 4-methylbenzenesulfonate
Perindopril intermediate
ethyl 4-(butylamino)benzoate
GTXRSQYDLPYYNW-UHFFFAOYSA-N
CCCCNC1=CC=C(C=C1)C(=O)OCC